C21H30O4S — CID 10809683
methyl 2-[(2S,3S,4R)-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10809683) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4R)-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,4R)-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10809683 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | methyl 2-[(2S,3S,4R)-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
| SMILES | CCCCCCCC[C@@H]1OC(=O)[C@H](Sc2ccccc2)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C21H30O4S/c1-3-4-5-6-7-11-14-18-17(15-19(22)24-2)20(21(23)25-18)26-16-12-9-8-10-13-16/h8-10,12-13,17-18,20H,3-7,11,14-15H2,1-2H3/t17-,18-,20+/m0/s1 |
| InChIKey | JKZSWPLBBRTEMI-CMKODMSKSA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|