C29H42O4S — CID 10961948
3-[(3E,7E)-4,8-dimethyl-12-(oxan-2-yloxy)dodeca-3,7-dienyl]-3-phenylsulfanyloxolan-2-one (PubChem CID 10961948) has the molecular formula C29H42O4S and a molecular weight of 486.72 g/mol. Its IUPAC name is 3-[(3E,7E)-4,8-dimethyl-12-(oxan-2-yloxy)dodeca-3,7-dienyl]-3-phenylsulfanyloxolan-2-one.
| Compound Name | 3-[(3E,7E)-4,8-dimethyl-12-(oxan-2-yloxy)dodeca-3,7-dienyl]-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10961948 |
| Molecular Formula | C29H42O4S |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 3-[(3E,7E)-4,8-dimethyl-12-(oxan-2-yloxy)dodeca-3,7-dienyl]-3-phenylsulfanyloxolan-2-one |
| SMILES | C/C(=C\CCC1(Sc2ccccc2)CCOC1=O)CC/C=C(\C)CCCCOC1CCCCO1 |
| InChI | InChI=1S/C29H42O4S/c1-24(12-6-8-21-31-27-18-7-9-22-32-27)13-10-14-25(2)15-11-19-29(20-23-33-28(29)30)34-26-16-4-3-5-17-26/h3-5,13,15-17,27H,6-12,14,18-23H2,1-2H3/b24-13+,25-15+ |
| InChIKey | FEHQPPHMEKVAQX-SMEUBIMOSA-N |
| XLogP | 7.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|