C17H20O6S — CID 14630151
methyl (3aS,4S,5R,7aS)-4-(benzenesulfonyl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 14630151) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is methyl (3aS,4S,5R,7aS)-4-(benzenesulfonyl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aS,4S,5R,7aS)-4-(benzenesulfonyl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 14630151 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | methyl (3aS,4S,5R,7aS)-4-(benzenesulfonyl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)[C@H]1C=C[C@@H]2OC(C)(C)O[C@@H]2[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O6S/c1-17(2)22-13-10-9-12(16(18)21-3)15(14(13)23-17)24(19,20)11-7-5-4-6-8-11/h4-10,12-15H,1-3H3/t12-,13-,14-,15-/m0/s1 |
| InChIKey | OLTPRTUWKAHZHS-AJNGGQMLSA-N |
| XLogP | 1.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|