C21H30O6S — CID 11811676
ethyl (3R,4S)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methylhept-5-enoate (PubChem CID 11811676) has the molecular formula C21H30O6S and a molecular weight of 410.53 g/mol. Its IUPAC name is ethyl (3R,4S)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methylhept-5-enoate.
| Compound Name | ethyl (3R,4S)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methylhept-5-enoate |
|---|---|
| PubChem CID | 11811676 |
| Molecular Formula | C21H30O6S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | ethyl (3R,4S)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methylhept-5-enoate |
| SMILES | CCOC(=O)C[C@H]([C@H]1COC(C)(C)O1)[C@H](C=C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H30O6S/c1-6-25-20(22)13-17(18-14-26-21(4,5)27-18)19(12-15(2)3)28(23,24)16-10-8-7-9-11-16/h7-12,17-19H,6,13-14H2,1-5H3/t17-,18-,19+/m1/s1 |
| InChIKey | CQMQWNFTMBQTCM-QRVBRYPASA-N |
| XLogP | 3.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|