C20H28O8S — CID 102316434
dimethyl 2-[(1S)-2-(benzenesulfonyl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl]propanedioate (PubChem CID 102316434) has the molecular formula C20H28O8S and a molecular weight of 428.50 g/mol. Its IUPAC name is dimethyl 2-[(1S)-2-(benzenesulfonyl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl]propanedioate.
| Compound Name | dimethyl 2-[(1S)-2-(benzenesulfonyl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl]propanedioate |
|---|---|
| PubChem CID | 102316434 |
| Molecular Formula | C20H28O8S |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | dimethyl 2-[(1S)-2-(benzenesulfonyl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]([C@H]1COC(C)(C)O1)C(C)(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28O8S/c1-19(2,29(23,24)13-10-8-7-9-11-13)16(14-12-27-20(3,4)28-14)15(17(21)25-5)18(22)26-6/h7-11,14-16H,12H2,1-6H3/t14-,16-/m1/s1 |
| InChIKey | MWAZEGXWBCRCAY-GDBMZVCRSA-N |
| XLogP | 1.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|