C18H24O8S — CID 139791919
diethyl 2-[(3R,4S)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl]propanedioate (PubChem CID 139791919) has the molecular formula C18H24O8S and a molecular weight of 400.45 g/mol. Its IUPAC name is diethyl 2-[(3R,4S)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl]propanedioate.
| Compound Name | diethyl 2-[(3R,4S)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 139791919 |
| Molecular Formula | C18H24O8S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | diethyl 2-[(3R,4S)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1COC[C@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H24O8S/c1-4-24-17(19)16(18(20)25-5-2)14-10-23-11-15(14)26-27(21,22)13-8-6-12(3)7-9-13/h6-9,14-16H,4-5,10-11H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | JDXTZXFXYATCEL-HUUCEWRRSA-N |
| XLogP | 1.46 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|