C15H20O9S3 — CID 10026261
2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-methyl-4-methylsulfonyl-5-oxooxolan-3-yl]ethyl methanesulfonate (PubChem CID 10026261) has the molecular formula C15H20O9S3 and a molecular weight of 440.52 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-methyl-4-methylsulfonyl-5-oxooxolan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-methyl-4-methylsulfonyl-5-oxooxolan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 10026261 |
| Molecular Formula | C15H20O9S3 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-methyl-4-methylsulfonyl-5-oxooxolan-3-yl]ethyl methanesulfonate |
| SMILES | C[C@H]1OC(=O)[C@@](S(C)(=O)=O)(S(=O)(=O)c2ccccc2)[C@@H]1CCOS(C)(=O)=O |
| InChI | InChI=1S/C15H20O9S3/c1-11-13(9-10-23-26(3,19)20)15(14(16)24-11,25(2,17)18)27(21,22)12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3/t11-,13-,15+/m1/s1 |
| InChIKey | JCKVXLSBWWLRAN-KYOSRNDESA-N |
| XLogP | 0.13 |
| TPSA | 137.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|