C16H18O6S — CID 10042755
methyl 2-[(3R,4S)-4-(benzenesulfonyl)-5-oxo-4-prop-2-enyloxolan-3-yl]acetate (PubChem CID 10042755) has the molecular formula C16H18O6S and a molecular weight of 338.38 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-4-(benzenesulfonyl)-5-oxo-4-prop-2-enyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,4S)-4-(benzenesulfonyl)-5-oxo-4-prop-2-enyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10042755 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | methyl 2-[(3R,4S)-4-(benzenesulfonyl)-5-oxo-4-prop-2-enyloxolan-3-yl]acetate |
| SMILES | C=CC[C@@]1(S(=O)(=O)c2ccccc2)C(=O)OC[C@H]1CC(=O)OC |
| InChI | InChI=1S/C16H18O6S/c1-3-9-16(23(19,20)13-7-5-4-6-8-13)12(10-14(17)21-2)11-22-15(16)18/h3-8,12H,1,9-11H2,2H3/t12-,16+/m1/s1 |
| InChIKey | GICGLHRPWLWZHS-WBMJQRKESA-N |
| XLogP | 1.51 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|