C16H18O8S — CID 10384514
methyl 2-[(3R,4S)-4-(benzenesulfonyl)-4-(2-methoxy-2-oxoethyl)-5-oxooxolan-3-yl]acetate (PubChem CID 10384514) has the molecular formula C16H18O8S and a molecular weight of 370.38 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-4-(benzenesulfonyl)-4-(2-methoxy-2-oxoethyl)-5-oxooxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,4S)-4-(benzenesulfonyl)-4-(2-methoxy-2-oxoethyl)-5-oxooxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10384514 |
| Molecular Formula | C16H18O8S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | methyl 2-[(3R,4S)-4-(benzenesulfonyl)-4-(2-methoxy-2-oxoethyl)-5-oxooxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1COC(=O)[C@@]1(CC(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O8S/c1-22-13(17)8-11-10-24-15(19)16(11,9-14(18)23-2)25(20,21)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3/t11-,16+/m1/s1 |
| InChIKey | IXZLKJMTSGEFCQ-BZNIZROVSA-N |
| XLogP | 0.50 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|