C25H30O8S2 — CID 11489320
(E,7S)-8,8-bis(benzenesulfonyl)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-5-enoic acid (PubChem CID 11489320) has the molecular formula C25H30O8S2 and a molecular weight of 522.64 g/mol. Its IUPAC name is (E,7S)-8,8-bis(benzenesulfonyl)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-5-enoic acid.
| Compound Name | (E,7S)-8,8-bis(benzenesulfonyl)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-5-enoic acid |
|---|---|
| PubChem CID | 11489320 |
| Molecular Formula | C25H30O8S2 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (E,7S)-8,8-bis(benzenesulfonyl)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-5-enoic acid |
| SMILES | CC1(C)OC[C@H]([C@H](/C=C/CCCC(=O)O)C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C25H30O8S2/c1-25(2)32-18-22(33-25)21(16-10-5-11-17-23(26)27)24(34(28,29)19-12-6-3-7-13-19)35(30,31)20-14-8-4-9-15-20/h3-4,6-10,12-16,21-22,24H,5,11,17-18H2,1-2H3,(H,26,27)/b16-10+/t21-,22+/m0/s1 |
| InChIKey | DQIGDZONHYIKLC-XAYCBPNJSA-N |
| XLogP | 3.84 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|