C18H24O6S — CID 102122736
methyl (3S,4R)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate (PubChem CID 102122736) has the molecular formula C18H24O6S and a molecular weight of 368.45 g/mol. Its IUPAC name is methyl (3S,4R)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate.
| Compound Name | methyl (3S,4R)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate |
|---|---|
| PubChem CID | 102122736 |
| Molecular Formula | C18H24O6S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | methyl (3S,4R)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate |
| SMILES | C=C[C@H]([C@@H](CC(=O)OC)[C@H]1COC(C)(C)O1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24O6S/c1-5-16(25(20,21)13-9-7-6-8-10-13)14(11-17(19)22-4)15-12-23-18(2,3)24-15/h5-10,14-16H,1,11-12H2,2-4H3/t14-,15+,16+/m0/s1 |
| InChIKey | NCPJSLNLGGHSKZ-ARFHVFGLSA-N |
| XLogP | 2.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|