C19H26O6S — CID 102122735
ethyl (3R,4S)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate (PubChem CID 102122735) has the molecular formula C19H26O6S and a molecular weight of 382.48 g/mol. Its IUPAC name is ethyl (3R,4S)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate.
| Compound Name | ethyl (3R,4S)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate |
|---|---|
| PubChem CID | 102122735 |
| Molecular Formula | C19H26O6S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | ethyl (3R,4S)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-enoate |
| SMILES | C=C[C@@H]([C@H](CC(=O)OCC)[C@H]1COC(C)(C)O1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26O6S/c1-5-17(26(21,22)14-10-8-7-9-11-14)15(12-18(20)23-6-2)16-13-24-19(3,4)25-16/h5,7-11,15-17H,1,6,12-13H2,2-4H3/t15-,16-,17+/m1/s1 |
| InChIKey | RTRRYZMWTDNDNX-ZACQAIPSSA-N |
| XLogP | 2.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|