C18H24O7S — CID 10949006
[(2R,3R,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-3-methyl-6-phenylsulfanyloxan-4-yl] 4-oxopentanoate (PubChem CID 10949006) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-3-methyl-6-phenylsulfanyloxan-4-yl] 4-oxopentanoate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-3-methyl-6-phenylsulfanyloxan-4-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 10949006 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-3-methyl-6-phenylsulfanyloxan-4-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)O[C@H](CO)[C@@]1(C)O |
| InChI | InChI=1S/C18H24O7S/c1-11(20)8-9-14(21)25-16-15(22)17(24-13(10-19)18(16,2)23)26-12-6-4-3-5-7-12/h3-7,13,15-17,19,22-23H,8-10H2,1-2H3/t13-,15-,16-,17+,18-/m1/s1 |
| InChIKey | VMNVQSVFUGWWNA-FXXCCUJSSA-N |
| XLogP | 0.89 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |