C18H28O4S — CID 10020164
[(2S,3R)-1,2-dihydroxy-2-methylnonan-3-yl] 2-phenylsulfanylacetate (PubChem CID 10020164) has the molecular formula C18H28O4S and a molecular weight of 340.48 g/mol. Its IUPAC name is [(2S,3R)-1,2-dihydroxy-2-methylnonan-3-yl] 2-phenylsulfanylacetate.
| Compound Name | [(2S,3R)-1,2-dihydroxy-2-methylnonan-3-yl] 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 10020164 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [(2S,3R)-1,2-dihydroxy-2-methylnonan-3-yl] 2-phenylsulfanylacetate |
| SMILES | CCCCCC[C@@H](OC(=O)CSc1ccccc1)[C@@](C)(O)CO |
| InChI | InChI=1S/C18H28O4S/c1-3-4-5-9-12-16(18(2,21)14-19)22-17(20)13-23-15-10-7-6-8-11-15/h6-8,10-11,16,19,21H,3-5,9,12-14H2,1-2H3/t16-,18+/m1/s1 |
| InChIKey | XOVIJDDARYNJQY-AEFFLSMTSA-N |
| XLogP | 3.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|