C17H26O5S2 — CID 135050718
[(2S)-2-hydroxy-2-[(2S)-6-phenylsulfanyl-6-propan-2-yloxan-2-yl]ethyl] methanesulfonate (PubChem CID 135050718) has the molecular formula C17H26O5S2 and a molecular weight of 374.52 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[(2S)-6-phenylsulfanyl-6-propan-2-yloxan-2-yl]ethyl] methanesulfonate.
| Compound Name | [(2S)-2-hydroxy-2-[(2S)-6-phenylsulfanyl-6-propan-2-yloxan-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 135050718 |
| Molecular Formula | C17H26O5S2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [(2S)-2-hydroxy-2-[(2S)-6-phenylsulfanyl-6-propan-2-yloxan-2-yl]ethyl] methanesulfonate |
| SMILES | CC(C)C1(Sc2ccccc2)CCC[C@@H]([C@@H](O)COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C17H26O5S2/c1-13(2)17(23-14-8-5-4-6-9-14)11-7-10-16(22-17)15(18)12-21-24(3,19)20/h4-6,8-9,13,15-16,18H,7,10-12H2,1-3H3/t15-,16-,17?/m0/s1 |
| InChIKey | KKOPJTRIUZEZST-PYNWJHIZSA-N |
| XLogP | 3.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|