C15H20O4S — CID 100978493
ethyl 2-hydroxy-2-(2-phenylsulfanyloxan-3-yl)acetate (PubChem CID 100978493) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(2-phenylsulfanyloxan-3-yl)acetate.
| Compound Name | ethyl 2-hydroxy-2-(2-phenylsulfanyloxan-3-yl)acetate |
|---|---|
| PubChem CID | 100978493 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | ethyl 2-hydroxy-2-(2-phenylsulfanyloxan-3-yl)acetate |
| SMILES | CCOC(=O)C(O)C1CCCOC1Sc1ccccc1 |
| InChI | InChI=1S/C15H20O4S/c1-2-18-14(17)13(16)12-9-6-10-19-15(12)20-11-7-4-3-5-8-11/h3-5,7-8,12-13,15-16H,2,6,9-10H2,1H3 |
| InChIKey | OESJEARLUOAEHS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |