C18H22O7S — CID 72697099
ethyl (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate (PubChem CID 72697099) has the molecular formula C18H22O7S and a molecular weight of 382.43 g/mol. Its IUPAC name is ethyl (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate.
| Compound Name | ethyl (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
|---|---|
| PubChem CID | 72697099 |
| Molecular Formula | C18H22O7S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl (2R,3S,3aR,6aS)-2-(hydroxymethyl)-5-methyl-3-(4-methylphenyl)sulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)O[C@@H]2O[C@H](CO)[C@@H](S(=O)(=O)c3ccc(C)cc3)[C@H]12 |
| InChI | InChI=1S/C18H22O7S/c1-4-23-17(20)14-11(3)24-18-15(14)16(13(9-19)25-18)26(21,22)12-7-5-10(2)6-8-12/h5-8,13,15-16,18-19H,4,9H2,1-3H3/t13-,15+,16-,18-/m1/s1 |
| InChIKey | JPEVNWUSQKABRU-NOVWEMISSA-N |
| XLogP | 1.34 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |