C31H34O8S — CID 50924662
dimethyl (3S,4R,5R)-3-(4-methylphenyl)sulfonyl-4,5-bis(phenylmethoxy)cyclohexane-1,1-dicarboxylate (PubChem CID 50924662) has the molecular formula C31H34O8S and a molecular weight of 566.67 g/mol. Its IUPAC name is dimethyl (3S,4R,5R)-3-(4-methylphenyl)sulfonyl-4,5-bis(phenylmethoxy)cyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl (3S,4R,5R)-3-(4-methylphenyl)sulfonyl-4,5-bis(phenylmethoxy)cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 50924662 |
| Molecular Formula | C31H34O8S |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | dimethyl (3S,4R,5R)-3-(4-methylphenyl)sulfonyl-4,5-bis(phenylmethoxy)cyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C31H34O8S/c1-22-14-16-25(17-15-22)40(34,35)27-19-31(29(32)36-2,30(33)37-3)18-26(38-20-23-10-6-4-7-11-23)28(27)39-21-24-12-8-5-9-13-24/h4-17,26-28H,18-21H2,1-3H3/t26-,27+,28-/m1/s1 |
| InChIKey | JUDNAKQDHRNVOG-OZNIXHKMSA-N |
| XLogP | 4.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|