C41H46O9S — CID 45139369
diethyl (2S,3R,4R)-2-[1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfonyl-3-phenylmethoxycyclopentane-1,1-dicarboxylate (PubChem CID 45139369) has the molecular formula C41H46O9S and a molecular weight of 714.88 g/mol. Its IUPAC name is diethyl (2S,3R,4R)-2-[1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfonyl-3-phenylmethoxycyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (2S,3R,4R)-2-[1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfonyl-3-phenylmethoxycyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 45139369 |
| Molecular Formula | C41H46O9S |
| Molecular Weight | 714.88 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | diethyl (2S,3R,4R)-2-[1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfonyl-3-phenylmethoxycyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](S(=O)(=O)c2ccc(C)cc2)[C@H](OCc2ccccc2)[C@@H]1C(COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C41H46O9S/c1-4-47-39(42)41(40(43)48-5-2)25-36(51(44,45)34-23-21-30(3)22-24-34)38(50-28-33-19-13-8-14-20-33)37(41)35(49-27-32-17-11-7-12-18-32)29-46-26-31-15-9-6-10-16-31/h6-24,35-38H,4-5,25-29H2,1-3H3/t35?,36-,37+,38+/m1/s1 |
| InChIKey | CHKFCXVKSMYORE-ZLBBOYHMSA-N |
| XLogP | 6.66 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.88 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|