C32H38O11S2 — CID 50924816
dimethyl 2-[(2S,3R,4R)-2-(4-methylphenyl)sulfonyl-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)pentyl]propanedioate (PubChem CID 50924816) has the molecular formula C32H38O11S2 and a molecular weight of 662.78 g/mol. Its IUPAC name is dimethyl 2-[(2S,3R,4R)-2-(4-methylphenyl)sulfonyl-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)pentyl]propanedioate.
| Compound Name | dimethyl 2-[(2S,3R,4R)-2-(4-methylphenyl)sulfonyl-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)pentyl]propanedioate |
|---|---|
| PubChem CID | 50924816 |
| Molecular Formula | C32H38O11S2 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | dimethyl 2-[(2S,3R,4R)-2-(4-methylphenyl)sulfonyl-5-methylsulfonyloxy-3,4-bis(phenylmethoxy)pentyl]propanedioate |
| SMILES | COC(=O)C(C[C@@H]([C@H](OCc1ccccc1)[C@@H](COS(C)(=O)=O)OCc1ccccc1)S(=O)(=O)c1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C32H38O11S2/c1-23-15-17-26(18-16-23)45(37,38)29(19-27(31(33)39-2)32(34)40-3)30(42-21-25-13-9-6-10-14-25)28(22-43-44(4,35)36)41-20-24-11-7-5-8-12-24/h5-18,27-30H,19-22H2,1-4H3/t28-,29+,30-/m1/s1 |
| InChIKey | BUXHXHUYYYOVMK-DYIKCSJPSA-N |
| XLogP | 3.64 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|