C36H44O8S — CID 11104176
methyl (2S,3S,4E)-3-[(1S,2R)-1-methoxy-4-(4-methylphenyl)sulfonyloxy-2-phenylmethoxybutyl]-4-methyl-2-phenylmethoxyocta-4,7-dienoate (PubChem CID 11104176) has the molecular formula C36H44O8S and a molecular weight of 636.81 g/mol. Its IUPAC name is methyl (2S,3S,4E)-3-[(1S,2R)-1-methoxy-4-(4-methylphenyl)sulfonyloxy-2-phenylmethoxybutyl]-4-methyl-2-phenylmethoxyocta-4,7-dienoate.
| Compound Name | methyl (2S,3S,4E)-3-[(1S,2R)-1-methoxy-4-(4-methylphenyl)sulfonyloxy-2-phenylmethoxybutyl]-4-methyl-2-phenylmethoxyocta-4,7-dienoate |
|---|---|
| PubChem CID | 11104176 |
| Molecular Formula | C36H44O8S |
| Molecular Weight | 636.81 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | methyl (2S,3S,4E)-3-[(1S,2R)-1-methoxy-4-(4-methylphenyl)sulfonyloxy-2-phenylmethoxybutyl]-4-methyl-2-phenylmethoxyocta-4,7-dienoate |
| SMILES | C=CC/C=C(\C)[C@@H]([C@H](OC)[C@@H](CCOS(=O)(=O)c1ccc(C)cc1)OCc1ccccc1)[C@H](OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C36H44O8S/c1-6-7-14-28(3)33(35(36(37)41-5)43-26-30-17-12-9-13-18-30)34(40-4)32(42-25-29-15-10-8-11-16-29)23-24-44-45(38,39)31-21-19-27(2)20-22-31/h6,8-22,32-35H,1,7,23-26H2,2-5H3/b28-14+/t32-,33+,34-,35+/m1/s1 |
| InChIKey | MAEWJWYVPMYJOY-ANRACTSBSA-N |
| XLogP | 6.59 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.81 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|