C32H36O5 — CID 10505552
methyl (3S,4R,5R,6S)-3-ethenyl-4,5,6-tris(phenylmethoxy)oct-7-enoate (PubChem CID 10505552) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is methyl (3S,4R,5R,6S)-3-ethenyl-4,5,6-tris(phenylmethoxy)oct-7-enoate.
| Compound Name | methyl (3S,4R,5R,6S)-3-ethenyl-4,5,6-tris(phenylmethoxy)oct-7-enoate |
|---|---|
| PubChem CID | 10505552 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | methyl (3S,4R,5R,6S)-3-ethenyl-4,5,6-tris(phenylmethoxy)oct-7-enoate |
| SMILES | C=C[C@H](CC(=O)OC)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C32H36O5/c1-4-28(21-30(33)34-3)31(36-23-26-17-11-7-12-18-26)32(37-24-27-19-13-8-14-20-27)29(5-2)35-22-25-15-9-6-10-16-25/h4-20,28-29,31-32H,1-2,21-24H2,3H3/t28-,29+,31-,32-/m1/s1 |
| InChIKey | JPZYZDLDCQRJEE-JARMDKEPSA-N |
| XLogP | 6.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|