C45H46O10S — CID 44543343
dimethyl 2-[(2S,3R,4R,5S,6R)-2-methoxy-5-(4-methylphenyl)sulfonyl-3-phenylmethoxy-6-(trityloxymethyl)oxan-4-yl]propanedioate (PubChem CID 44543343) has the molecular formula C45H46O10S and a molecular weight of 778.92 g/mol. Its IUPAC name is dimethyl 2-[(2S,3R,4R,5S,6R)-2-methoxy-5-(4-methylphenyl)sulfonyl-3-phenylmethoxy-6-(trityloxymethyl)oxan-4-yl]propanedioate.
| Compound Name | dimethyl 2-[(2S,3R,4R,5S,6R)-2-methoxy-5-(4-methylphenyl)sulfonyl-3-phenylmethoxy-6-(trityloxymethyl)oxan-4-yl]propanedioate |
|---|---|
| PubChem CID | 44543343 |
| Molecular Formula | C45H46O10S |
| Molecular Weight | 778.92 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | dimethyl 2-[(2S,3R,4R,5S,6R)-2-methoxy-5-(4-methylphenyl)sulfonyl-3-phenylmethoxy-6-(trityloxymethyl)oxan-4-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OC)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C45H46O10S/c1-31-25-27-36(28-26-31)56(48,49)41-37(30-54-45(33-19-11-6-12-20-33,34-21-13-7-14-22-34)35-23-15-8-16-24-35)55-44(52-4)40(53-29-32-17-9-5-10-18-32)38(41)39(42(46)50-2)43(47)51-3/h5-28,37-41,44H,29-30H2,1-4H3/t37-,38-,40-,41-,44+/m1/s1 |
| InChIKey | CPPXEUXMKUDHJU-XDSIAZFUSA-N |
| XLogP | 6.68 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.92 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|