C36H38O6S — CID 71619762
methyl 2-[(2R,3R,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate (PubChem CID 71619762) has the molecular formula C36H38O6S and a molecular weight of 598.76 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 71619762 |
| Molecular Formula | C36H38O6S |
| Molecular Weight | 598.76 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | methyl 2-[(2R,3R,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@@H](Sc2ccc(C)cc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H38O6S/c1-26-18-20-30(21-19-26)43-36-35(41-25-29-16-10-5-11-17-29)34(40-24-28-14-8-4-9-15-28)33(31(42-36)22-32(37)38-2)39-23-27-12-6-3-7-13-27/h3-21,31,33-36H,22-25H2,1-2H3/t31-,33-,34+,35-,36+/m1/s1 |
| InChIKey | NGOUBEFOXQKXBT-BOYYEFAASA-N |
| XLogP | 7.13 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.76 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |