C39H42O9S — CID 45139368
dimethyl (2S,3R,4R)-2-[1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfonyl-3-phenylmethoxycyclopentane-1,1-dicarboxylate (PubChem CID 45139368) has the molecular formula C39H42O9S and a molecular weight of 686.82 g/mol. Its IUPAC name is dimethyl (2S,3R,4R)-2-[1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfonyl-3-phenylmethoxycyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (2S,3R,4R)-2-[1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfonyl-3-phenylmethoxycyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 45139368 |
| Molecular Formula | C39H42O9S |
| Molecular Weight | 686.82 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | dimethyl (2S,3R,4R)-2-[1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfonyl-3-phenylmethoxycyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H](S(=O)(=O)c2ccc(C)cc2)[C@H](OCc2ccccc2)[C@@H]1C(COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C39H42O9S/c1-28-19-21-32(22-20-28)49(42,43)34-23-39(37(40)44-2,38(41)45-3)35(36(34)48-26-31-17-11-6-12-18-31)33(47-25-30-15-9-5-10-16-30)27-46-24-29-13-7-4-8-14-29/h4-22,33-36H,23-27H2,1-3H3/t33?,34-,35+,36+/m1/s1 |
| InChIKey | UCEZXVQMKCYZDQ-HMVKWVIFSA-N |
| XLogP | 5.88 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.82 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|