C39H44O6S — CID 101009722
methyl 2-methyl-2-[(2S,3S,4S,5S,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate (PubChem CID 101009722) has the molecular formula C39H44O6S and a molecular weight of 640.84 g/mol. Its IUPAC name is methyl 2-methyl-2-[(2S,3S,4S,5S,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate.
| Compound Name | methyl 2-methyl-2-[(2S,3S,4S,5S,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 101009722 |
| Molecular Formula | C39H44O6S |
| Molecular Weight | 640.84 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | methyl 2-methyl-2-[(2S,3S,4S,5S,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
| SMILES | COC(=O)C(C)(C)[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C39H44O6S/c1-28-20-22-32(23-21-28)46-36-35(44-26-31-18-12-7-13-19-31)34(43-25-30-16-10-6-11-17-30)33(27-42-24-29-14-8-5-9-15-29)45-37(36)39(2,3)38(40)41-4/h5-23,33-37H,24-27H2,1-4H3/t33-,34+,35+,36-,37-/m1/s1 |
| InChIKey | AGDGFZQGXKZGCB-WNRBQEJJSA-N |
| XLogP | 7.81 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.84 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |