C30H38O5S — CID 51354546
ethyl (3Z,3aS,4R,6aS)-3-[1-(benzenesulfonyl)propan-2-ylidene]-5,5,6a-trimethyl-4-phenylmethoxy-1,2,4,6-tetrahydropentalene-3a-carboxylate (PubChem CID 51354546) has the molecular formula C30H38O5S and a molecular weight of 510.70 g/mol. Its IUPAC name is ethyl (3Z,3aS,4R,6aS)-3-[1-(benzenesulfonyl)propan-2-ylidene]-5,5,6a-trimethyl-4-phenylmethoxy-1,2,4,6-tetrahydropentalene-3a-carboxylate.
| Compound Name | ethyl (3Z,3aS,4R,6aS)-3-[1-(benzenesulfonyl)propan-2-ylidene]-5,5,6a-trimethyl-4-phenylmethoxy-1,2,4,6-tetrahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 51354546 |
| Molecular Formula | C30H38O5S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | ethyl (3Z,3aS,4R,6aS)-3-[1-(benzenesulfonyl)propan-2-ylidene]-5,5,6a-trimethyl-4-phenylmethoxy-1,2,4,6-tetrahydropentalene-3a-carboxylate |
| SMILES | CCOC(=O)[C@]12/C(=C(/C)CS(=O)(=O)c3ccccc3)CC[C@@]1(C)CC(C)(C)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C30H38O5S/c1-6-34-27(31)30-25(22(2)20-36(32,33)24-15-11-8-12-16-24)17-18-29(30,5)21-28(3,4)26(30)35-19-23-13-9-7-10-14-23/h7-16,26H,6,17-21H2,1-5H3/b25-22-/t26-,29+,30-/m1/s1 |
| InChIKey | RPRWJHFSLHTXOK-WFDJTZMLSA-N |
| XLogP | 6.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|