C30H38O3S — CID 51354262
ethyl (3E,3aS,4R,6aS)-5,5,6a-trimethyl-4-phenylmethoxy-3-(1-phenylsulfanylpropan-2-ylidene)-1,2,4,6-tetrahydropentalene-3a-carboxylate (PubChem CID 51354262) has the molecular formula C30H38O3S and a molecular weight of 478.70 g/mol. Its IUPAC name is ethyl (3E,3aS,4R,6aS)-5,5,6a-trimethyl-4-phenylmethoxy-3-(1-phenylsulfanylpropan-2-ylidene)-1,2,4,6-tetrahydropentalene-3a-carboxylate.
| Compound Name | ethyl (3E,3aS,4R,6aS)-5,5,6a-trimethyl-4-phenylmethoxy-3-(1-phenylsulfanylpropan-2-ylidene)-1,2,4,6-tetrahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 51354262 |
| Molecular Formula | C30H38O3S |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | ethyl (3E,3aS,4R,6aS)-5,5,6a-trimethyl-4-phenylmethoxy-3-(1-phenylsulfanylpropan-2-ylidene)-1,2,4,6-tetrahydropentalene-3a-carboxylate |
| SMILES | CCOC(=O)[C@]12/C(=C(\C)CSc3ccccc3)CC[C@@]1(C)CC(C)(C)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C30H38O3S/c1-6-32-27(31)30-25(22(2)20-34-24-15-11-8-12-16-24)17-18-29(30,5)21-28(3,4)26(30)33-19-23-13-9-7-10-14-23/h7-16,26H,6,17-21H2,1-5H3/b25-22+/t26-,29+,30-/m1/s1 |
| InChIKey | QIBDUIDTAFFDIF-SGUQBTFCSA-N |
| XLogP | 7.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|