C34H42O6S — CID 70492139
2-[2-[(3aR,4R,5R,6aS)-5-benzoyloxy-4-(3-benzoyloxyoct-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid (PubChem CID 70492139) has the molecular formula C34H42O6S and a molecular weight of 578.77 g/mol. Its IUPAC name is 2-[2-[(3aR,4R,5R,6aS)-5-benzoyloxy-4-(3-benzoyloxyoct-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(3aR,4R,5R,6aS)-5-benzoyloxy-4-(3-benzoyloxyoct-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 70492139 |
| Molecular Formula | C34H42O6S |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 2-[2-[(3aR,4R,5R,6aS)-5-benzoyloxy-4-(3-benzoyloxyoct-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid |
| SMILES | CCCCCC(C=C[C@@H]1[C@@H]2CC(CCSCC(=O)O)C[C@H]2C[C@H]1OC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H42O6S/c1-2-3-6-15-28(39-33(37)25-11-7-4-8-12-25)16-17-29-30-21-24(18-19-41-23-32(35)36)20-27(30)22-31(29)40-34(38)26-13-9-5-10-14-26/h4-5,7-14,16-17,24,27-31H,2-3,6,15,18-23H2,1H3,(H,35,36)/t24?,27-,28?,29+,30+,31+/m0/s1 |
| InChIKey | MAGXLOGAXQYQQS-RCGKUEEDSA-N |
| XLogP | 7.44 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|