C20H22O5S — CID 15503154
ethyl 2-[3-(benzenesulfonyl)-5-phenyloxolan-2-yl]acetate (PubChem CID 15503154) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is ethyl 2-[3-(benzenesulfonyl)-5-phenyloxolan-2-yl]acetate.
| Compound Name | ethyl 2-[3-(benzenesulfonyl)-5-phenyloxolan-2-yl]acetate |
|---|---|
| PubChem CID | 15503154 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | ethyl 2-[3-(benzenesulfonyl)-5-phenyloxolan-2-yl]acetate |
| SMILES | CCOC(=O)CC1OC(c2ccccc2)CC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O5S/c1-2-24-20(21)14-18-19(26(22,23)16-11-7-4-8-12-16)13-17(25-18)15-9-5-3-6-10-15/h3-12,17-19H,2,13-14H2,1H3 |
| InChIKey | CYSWIUHYDDTNBY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |