C21H24O5S — CID 11326694
ethyl 2-[(3S,6R)-3-(benzenesulfonyl)-6-phenyloxan-2-yl]acetate (PubChem CID 11326694) has the molecular formula C21H24O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is ethyl 2-[(3S,6R)-3-(benzenesulfonyl)-6-phenyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(3S,6R)-3-(benzenesulfonyl)-6-phenyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 11326694 |
| Molecular Formula | C21H24O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | ethyl 2-[(3S,6R)-3-(benzenesulfonyl)-6-phenyloxan-2-yl]acetate |
| SMILES | CCOC(=O)CC1O[C@@H](c2ccccc2)CC[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24O5S/c1-2-25-21(22)15-19-20(27(23,24)17-11-7-4-8-12-17)14-13-18(26-19)16-9-5-3-6-10-16/h3-12,18-20H,2,13-15H2,1H3/t18-,19?,20+/m1/s1 |
| InChIKey | ATKFVBIQFOYQEV-ITIDOPETSA-N |
| XLogP | 3.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |