C22H25FO6S — CID 138968304
ethyl 2-[(2R,4R,6S)-6-(4-fluorophenyl)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate (PubChem CID 138968304) has the molecular formula C22H25FO6S and a molecular weight of 436.50 g/mol. Its IUPAC name is ethyl 2-[(2R,4R,6S)-6-(4-fluorophenyl)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,4R,6S)-6-(4-fluorophenyl)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 138968304 |
| Molecular Formula | C22H25FO6S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | ethyl 2-[(2R,4R,6S)-6-(4-fluorophenyl)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@@H](OS(=O)(=O)c2ccc(C)cc2)C[C@@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C22H25FO6S/c1-3-27-22(24)14-18-12-19(13-21(28-18)16-6-8-17(23)9-7-16)29-30(25,26)20-10-4-15(2)5-11-20/h4-11,18-19,21H,3,12-14H2,1-2H3/t18-,19-,21+/m1/s1 |
| InChIKey | IXUSGZWEQWKWDE-SBHAEUEKSA-N |
| XLogP | 4.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|