C24H26O5S — CID 134911745
(1R,4S,8R)-4-(4-methylphenyl)sulfonyl-8-[(1R)-1-phenylbutoxy]-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 134911745) has the molecular formula C24H26O5S and a molecular weight of 426.53 g/mol. Its IUPAC name is (1R,4S,8R)-4-(4-methylphenyl)sulfonyl-8-[(1R)-1-phenylbutoxy]-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (1R,4S,8R)-4-(4-methylphenyl)sulfonyl-8-[(1R)-1-phenylbutoxy]-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 134911745 |
| Molecular Formula | C24H26O5S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (1R,4S,8R)-4-(4-methylphenyl)sulfonyl-8-[(1R)-1-phenylbutoxy]-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | CCC[C@@H](O[C@@H]1C[C@@H]2C=C[C@@]1(S(=O)(=O)c1ccc(C)cc1)C(=O)O2)c1ccccc1 |
| InChI | InChI=1S/C24H26O5S/c1-3-7-21(18-8-5-4-6-9-18)29-22-16-19-14-15-24(22,23(25)28-19)30(26,27)20-12-10-17(2)11-13-20/h4-6,8-15,19,21-22H,3,7,16H2,1-2H3/t19-,21+,22+,24-/m0/s1 |
| InChIKey | UOOCUTKRVGEZRG-BQUSRXHISA-N |
| XLogP | 4.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|