C16H13F2O5S- — CID 164747559
2,2-difluoro-3-(4-methylphenyl)sulfonyloxy-3-phenylpropanoate (PubChem CID 164747559) has the molecular formula C16H13F2O5S- and a molecular weight of 355.34 g/mol. Its IUPAC name is 2,2-difluoro-3-(4-methylphenyl)sulfonyloxy-3-phenylpropanoate.
| Compound Name | 2,2-difluoro-3-(4-methylphenyl)sulfonyloxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 164747559 |
| Molecular Formula | C16H13F2O5S- |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2,2-difluoro-3-(4-methylphenyl)sulfonyloxy-3-phenylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OC(c2ccccc2)C(F)(F)C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H14F2O5S/c1-11-7-9-13(10-8-11)24(21,22)23-14(16(17,18)15(19)20)12-5-3-2-4-6-12/h2-10,14H,1H3,(H,19,20)/p-1 |
| InChIKey | LQRIVRXYMPQGOQ-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|