C17H16F2O6S — CID 54390514
methyl (2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 54390514) has the molecular formula C17H16F2O6S and a molecular weight of 386.37 g/mol. Its IUPAC name is methyl (2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-(4-methylphenyl)sulfonyloxypropanoate.
| Compound Name | methyl (2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-(4-methylphenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 54390514 |
| Molecular Formula | C17H16F2O6S |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | methyl (2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | COC(=O)[C@@H](OS(=O)(=O)c1ccc(C)cc1)[C@H](O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H16F2O6S/c1-10-3-6-12(7-4-10)26(22,23)25-16(17(21)24-2)15(20)13-8-5-11(18)9-14(13)19/h3-9,15-16,20H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | VGHQIADMCKAQOQ-CVEARBPZSA-N |
| XLogP | 2.25 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|