About ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate
ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate (PubChem CID 86638765) has the molecular formula C20H22F2O6S
and a molecular weight of 428.45 g/mol. Its IUPAC name is ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate |
| PubChem CID | 86638765 |
| Molecular Formula | C20H22F2O6S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(F)c(F)c([C@H](O)COS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H22F2O6S/c1-3-27-19(24)9-6-14-10-16(20(22)17(21)11-14)18(23)12-28-29(25,26)15-7-4-13(2)5-8-15/h4-5,7-8,10-11,18,23H,3,6,9,12H2,1-2H3/t18-/m1/s1 |
| InChIKey | PZUPPTNRVSWLFH-GOSISDBHSA-N |
| XLogP | 3.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate?
The IUPAC name of ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate (CID 86638765) is ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate.
What is the SMILES notation for ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate?
The canonical SMILES for ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate is CCOC(=O)CCc1cc(F)c(F)c([C@H](O)COS(=O)(=O)c2ccc(C)cc2)c1.
What is the InChIKey of ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate?
The InChIKey is PZUPPTNRVSWLFH-GOSISDBHSA-N. The full InChI is InChI=1S/C20H22F2O6S/c1-3-27-19(24)9-6-14-10-16(20(22)17(21)11-14)18(23)12-28-29(25,26)15-7-4-13(2)5-8-15/h4-5,7-8,10-11,18,23H,3,6,9,12H2,1-2H3/t18-/m1/s1.
What are the key properties of ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate?
ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate has a molecular weight of 428.45 g/mol, XLogP of 3.21, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate is sourced from PubChem (CID 86638765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).