C20H22F2O6S — CID 86638765
ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate (PubChem CID 86638765) has the molecular formula C20H22F2O6S and a molecular weight of 428.45 g/mol. Its IUPAC name is ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate.
| Compound Name | ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 86638765 |
| Molecular Formula | C20H22F2O6S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(F)c(F)c([C@H](O)COS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H22F2O6S/c1-3-27-19(24)9-6-14-10-16(20(22)17(21)11-14)18(23)12-28-29(25,26)15-7-4-13(2)5-8-15/h4-5,7-8,10-11,18,23H,3,6,9,12H2,1-2H3/t18-/m1/s1 |
| InChIKey | PZUPPTNRVSWLFH-GOSISDBHSA-N |
| XLogP | 3.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|