C20H19F3O5S — CID 140675527
cis-benzyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate (PubChem CID 140675527) has the molecular formula C20H19F3O5S and a molecular weight of 428.43 g/mol. Its IUPAC name is cis-benzyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate.
| Compound Name | cis-benzyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 140675527 |
| Molecular Formula | C20H19F3O5S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | cis-benzyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CC[C@@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H19F3O5S/c21-20(22,23)16-7-10-18(11-8-16)29(25,26)28-17-9-6-15(12-17)19(24)27-13-14-4-2-1-3-5-14/h1-5,7-8,10-11,15,17H,6,9,12-13H2/t15-,17+/m0/s1 |
| InChIKey | SRCPIXAMTDBGFN-DOTOQJQBSA-N |
| XLogP | 4.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|