C21H21F3O5S — CID 123773355
benzyl 3-methyl-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate (PubChem CID 123773355) has the molecular formula C21H21F3O5S and a molecular weight of 442.46 g/mol. Its IUPAC name is benzyl 3-methyl-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate.
| Compound Name | benzyl 3-methyl-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 123773355 |
| Molecular Formula | C21H21F3O5S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | benzyl 3-methyl-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate |
| SMILES | CC1(OS(=O)(=O)c2ccc(C(F)(F)F)cc2)CCC(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H21F3O5S/c1-20(29-30(26,27)18-9-7-17(8-10-18)21(22,23)24)12-11-16(13-20)19(25)28-14-15-5-3-2-4-6-15/h2-10,16H,11-14H2,1H3 |
| InChIKey | IXUVWWKTZWFPPV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|