C20H21F3O4S — CID 165037768
[3-[(3,4,5-trifluorophenyl)methoxy]cyclopentyl]methyl 4-methylbenzenesulfonate (PubChem CID 165037768) has the molecular formula C20H21F3O4S and a molecular weight of 414.45 g/mol. Its IUPAC name is [3-[(3,4,5-trifluorophenyl)methoxy]cyclopentyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-[(3,4,5-trifluorophenyl)methoxy]cyclopentyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 165037768 |
| Molecular Formula | C20H21F3O4S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [3-[(3,4,5-trifluorophenyl)methoxy]cyclopentyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCC(OCc3cc(F)c(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C20H21F3O4S/c1-13-2-6-17(7-3-13)28(24,25)27-12-14-4-5-16(8-14)26-11-15-9-18(21)20(23)19(22)10-15/h2-3,6-7,9-10,14,16H,4-5,8,11-12H2,1H3 |
| InChIKey | IFAIMJCHXNXMET-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|