C18H21FO5S — CID 13051654
[1-(4-fluorophenyl)-1,1-dimethoxypropan-2-yl] 4-methylbenzenesulfonate (PubChem CID 13051654) has the molecular formula C18H21FO5S and a molecular weight of 368.43 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-1,1-dimethoxypropan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-(4-fluorophenyl)-1,1-dimethoxypropan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13051654 |
| Molecular Formula | C18H21FO5S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [1-(4-fluorophenyl)-1,1-dimethoxypropan-2-yl] 4-methylbenzenesulfonate |
| SMILES | COC(OC)(c1ccc(F)cc1)C(C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21FO5S/c1-13-5-11-17(12-6-13)25(20,21)24-14(2)18(22-3,23-4)15-7-9-16(19)10-8-15/h5-12,14H,1-4H3 |
| InChIKey | KUYQEBCDDODNNP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|