C28H34O4S — CID 163359760
[2-[(E)-5-(benzenesulfonyl)pent-3-enyl]spiro[4.5]decan-3-yl] benzoate (PubChem CID 163359760) has the molecular formula C28H34O4S and a molecular weight of 466.64 g/mol. Its IUPAC name is [2-[(E)-5-(benzenesulfonyl)pent-3-enyl]spiro[4.5]decan-3-yl] benzoate.
| Compound Name | [2-[(E)-5-(benzenesulfonyl)pent-3-enyl]spiro[4.5]decan-3-yl] benzoate |
|---|---|
| PubChem CID | 163359760 |
| Molecular Formula | C28H34O4S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [2-[(E)-5-(benzenesulfonyl)pent-3-enyl]spiro[4.5]decan-3-yl] benzoate |
| SMILES | O=C(OC1CC2(CCCCC2)CC1CC/C=C/CS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O4S/c29-27(23-13-5-1-6-14-23)32-26-22-28(18-10-4-11-19-28)21-24(26)15-7-3-12-20-33(30,31)25-16-8-2-9-17-25/h1-3,5-6,8-9,12-14,16-17,24,26H,4,7,10-11,15,18-22H2/b12-3+ |
| InChIKey | GOOARJOLMFDGMG-KGVSQERTSA-N |
| XLogP | 6.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|