[2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate

C27H21FO6S2 — CID 134854341

IUPAC[2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate
SMILESO=C(OC(c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1
InChIInChI=1S/C27H21FO6S2/c28-27(35(30,31)23-17-9-3-10-18-23,36(32,33)24-19-11-4-12-20-24)25(21-13-5-1-6-14-21)34-26(29)22-15-7-2-8-16-22/h1-20,25H
InChIKeyXLNWQSYLEGDPLC-UHFFFAOYSA-N
MW524.59 g/mol
LogP5.16
Rot. Bonds8

About [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate

[2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate (PubChem CID 134854341) has the molecular formula C27H21FO6S2 and a molecular weight of 524.59 g/mol. Its IUPAC name is [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate.

Molecular Properties

Compound Name[2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate
PubChem CID134854341
Molecular FormulaC27H21FO6S2
Molecular Weight524.59 g/mol
Exact Mass524.08
IUPAC Name[2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate
SMILESO=C(OC(c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1
InChIInChI=1S/C27H21FO6S2/c28-27(35(30,31)23-17-9-3-10-18-23,36(32,33)24-19-11-4-12-20-24)25(21-13-5-1-6-14-21)34-26(29)22-15-7-2-8-16-22/h1-20,25H
InChIKeyXLNWQSYLEGDPLC-UHFFFAOYSA-N
XLogP5.16
TPSA94.58 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms36
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500524.59
LogP ≤ 55.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate?
The IUPAC name of [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate (CID 134854341) is [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate.
What is the SMILES notation for [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate?
The canonical SMILES for [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate is O=C(OC(c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate?
The InChIKey is XLNWQSYLEGDPLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21FO6S2/c28-27(35(30,31)23-17-9-3-10-18-23,36(32,33)24-19-11-4-12-20-24)25(21-13-5-1-6-14-21)34-26(29)22-15-7-2-8-16-22/h1-20,25H.
What are the key properties of [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate?
[2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate has a molecular weight of 524.59 g/mol, XLogP of 5.16, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate is sourced from PubChem (CID 134854341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).