C27H21FO6S2 — CID 134854341
[2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate (PubChem CID 134854341) has the molecular formula C27H21FO6S2 and a molecular weight of 524.59 g/mol. Its IUPAC name is [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate.
| Compound Name | [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate |
|---|---|
| PubChem CID | 134854341 |
| Molecular Formula | C27H21FO6S2 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | [2,2-bis(benzenesulfonyl)-2-fluoro-1-phenylethyl] benzoate |
| SMILES | O=C(OC(c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H21FO6S2/c28-27(35(30,31)23-17-9-3-10-18-23,36(32,33)24-19-11-4-12-20-24)25(21-13-5-1-6-14-21)34-26(29)22-15-7-2-8-16-22/h1-20,25H |
| InChIKey | XLNWQSYLEGDPLC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |