C8H18O2Si2 — CID 11241122
(5E)-5-ethylidene-2,2,4,4-tetramethyl-1,3,2,4-dioxadisilinane (PubChem CID 11241122) has the molecular formula C8H18O2Si2 and a molecular weight of 202.40 g/mol. Its IUPAC name is (5E)-5-ethylidene-2,2,4,4-tetramethyl-1,3,2,4-dioxadisilinane.
| Compound Name | (5E)-5-ethylidene-2,2,4,4-tetramethyl-1,3,2,4-dioxadisilinane |
|---|---|
| PubChem CID | 11241122 |
| Molecular Formula | C8H18O2Si2 |
| Molecular Weight | 202.40 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (5E)-5-ethylidene-2,2,4,4-tetramethyl-1,3,2,4-dioxadisilinane |
| SMILES | C/C=C1\CO[Si](C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C8H18O2Si2/c1-6-8-7-9-12(4,5)10-11(8,2)3/h6H,7H2,1-5H3/b8-6+ |
| InChIKey | QBULSOVDMQVNRT-SOFGYWHQSA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|