C18H27NSi — CID 11243123
N-benzyl-1-(2-trimethylsilylethynyl)cyclohexan-1-amine (PubChem CID 11243123) has the molecular formula C18H27NSi and a molecular weight of 285.51 g/mol. Its IUPAC name is N-benzyl-1-(2-trimethylsilylethynyl)cyclohexan-1-amine.
| Compound Name | N-benzyl-1-(2-trimethylsilylethynyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 11243123 |
| Molecular Formula | C18H27NSi |
| Molecular Weight | 285.51 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | N-benzyl-1-(2-trimethylsilylethynyl)cyclohexan-1-amine |
| SMILES | C[Si](C)(C)C#CC1(NCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H27NSi/c1-20(2,3)15-14-18(12-8-5-9-13-18)19-16-17-10-6-4-7-11-17/h4,6-7,10-11,19H,5,8-9,12-13,16H2,1-3H3 |
| InChIKey | QQTZOMALFXTTNS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|