C22H33N5 — CID 151270644
2-(N-aminoanilino)-2-N-benzyl-1-N,1-N',1-N'-trimethylcyclohexane-1,1,2-triamine (PubChem CID 151270644) has the molecular formula C22H33N5 and a molecular weight of 367.54 g/mol. Its IUPAC name is 2-(N-aminoanilino)-2-N-benzyl-1-N,1-N',1-N'-trimethylcyclohexane-1,1,2-triamine.
| Compound Name | 2-(N-aminoanilino)-2-N-benzyl-1-N,1-N',1-N'-trimethylcyclohexane-1,1,2-triamine |
|---|---|
| PubChem CID | 151270644 |
| Molecular Formula | C22H33N5 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 2-(N-aminoanilino)-2-N-benzyl-1-N,1-N',1-N'-trimethylcyclohexane-1,1,2-triamine |
| SMILES | CNC1(N(C)C)CCCCC1(NCc1ccccc1)N(N)c1ccccc1 |
| InChI | InChI=1S/C22H33N5/c1-24-21(26(2)3)16-10-11-17-22(21,25-18-19-12-6-4-7-13-19)27(23)20-14-8-5-9-15-20/h4-9,12-15,24-25H,10-11,16-18,23H2,1-3H3 |
| InChIKey | NWHCBHAUNSZCKZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|