C18H26O4 — CID 11243704
3-(cyclohexanecarbonyl)-5-(cyclohexylmethyl)oxolane-2,4-dione (PubChem CID 11243704) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 3-(cyclohexanecarbonyl)-5-(cyclohexylmethyl)oxolane-2,4-dione.
| Compound Name | 3-(cyclohexanecarbonyl)-5-(cyclohexylmethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 11243704 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-(cyclohexanecarbonyl)-5-(cyclohexylmethyl)oxolane-2,4-dione |
| SMILES | O=C1OC(CC2CCCCC2)C(=O)C1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H26O4/c19-16(13-9-5-2-6-10-13)15-17(20)14(22-18(15)21)11-12-7-3-1-4-8-12/h12-15H,1-11H2 |
| InChIKey | BZJXWHOUIQWVGH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|