C18H28O4 — CID 11243772
(1S,2S,5R,7R,10S,11S,13S,15R)-5,13-dihydroxy-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecan-14-one (PubChem CID 11243772) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (1S,2S,5R,7R,10S,11S,13S,15R)-5,13-dihydroxy-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecan-14-one.
| Compound Name | (1S,2S,5R,7R,10S,11S,13S,15R)-5,13-dihydroxy-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecan-14-one |
|---|---|
| PubChem CID | 11243772 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (1S,2S,5R,7R,10S,11S,13S,15R)-5,13-dihydroxy-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecan-14-one |
| SMILES | C[C@]12CC[C@@H](O)C[C@H]1CC[C@@H]1[C@@H]2OC[C@]2(C)C(=O)[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C18H28O4/c1-17-6-5-11(19)7-10(17)3-4-12-13-8-14(20)15(21)18(13,2)9-22-16(12)17/h10-14,16,19-20H,3-9H2,1-2H3/t10-,11-,12+,13+,14+,16+,17+,18+/m1/s1 |
| InChIKey | HRNBXXROLFNZOD-GBPRJRMISA-N |
| XLogP | 1.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |