C18H30O4 — CID 11266896
(1S,2S,5R,7R,10S,11S,13S,14R,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecane-5,13,14-triol (PubChem CID 11266896) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (1S,2S,5R,7R,10S,11S,13S,14R,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecane-5,13,14-triol.
| Compound Name | (1S,2S,5R,7R,10S,11S,13S,14R,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecane-5,13,14-triol |
|---|---|
| PubChem CID | 11266896 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (1S,2S,5R,7R,10S,11S,13S,14R,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecane-5,13,14-triol |
| SMILES | C[C@]12CC[C@@H](O)C[C@H]1CC[C@H]1[C@@H]3C[C@H](O)[C@H](O)[C@@]3(C)CO[C@@H]12 |
| InChI | InChI=1S/C18H30O4/c1-17-6-5-11(19)7-10(17)3-4-12-13-8-14(20)15(21)18(13,2)9-22-16(12)17/h10-16,19-21H,3-9H2,1-2H3/t10-,11-,12+,13+,14+,15+,16+,17+,18+/m1/s1 |
| InChIKey | UDVLKUDWGRFIDJ-QKRPOWTLSA-N |
| XLogP | 1.71 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |