C19H32O4 — CID 69044732
(2S,3S,8R,9S,10S,13S,14S,16R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-2,3,16,17-tetrol (PubChem CID 69044732) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (2S,3S,8R,9S,10S,13S,14S,16R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-2,3,16,17-tetrol.
| Compound Name | (2S,3S,8R,9S,10S,13S,14S,16R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-2,3,16,17-tetrol |
|---|---|
| PubChem CID | 69044732 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (2S,3S,8R,9S,10S,13S,14S,16R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-2,3,16,17-tetrol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4C[C@H](O)[C@@H](O)C[C@@]43C)[C@@H]1C[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C19H32O4/c1-18-6-5-12-11(13(18)8-15(21)17(18)23)4-3-10-7-14(20)16(22)9-19(10,12)2/h10-17,20-23H,3-9H2,1-2H3/t10?,11-,12+,13+,14+,15-,16+,17+,18+,19+/m1/s1 |
| InChIKey | CLNSSHHJJYZUKV-YRXMNRLZSA-N |
| XLogP | 1.69 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |