C23H38O5 — CID 162865060
1-(2,3,16-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate (PubChem CID 162865060) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 1-(2,3,16-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate.
| Compound Name | 1-(2,3,16-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate |
|---|---|
| PubChem CID | 162865060 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1-(2,3,16-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate |
| SMILES | CC(=O)OC(C)C1C(O)CC2C3CCC4CC(O)C(O)CC4(C)C3CCC21C |
| InChI | InChI=1S/C23H38O5/c1-12(28-13(2)24)21-19(26)10-17-15-6-5-14-9-18(25)20(27)11-23(14,4)16(15)7-8-22(17,21)3/h12,14-21,25-27H,5-11H2,1-4H3 |
| InChIKey | RONVFHDKERFTPP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |